C16H10FNO2 — CID 22550367
3-(3-fluoroanilino)-4-phenylcyclobut-3-ene-1,2-dione (PubChem CID 22550367) has the molecular formula C16H10FNO2 and a molecular weight of 267.26 g/mol. Its IUPAC name is 3-(3-fluoroanilino)-4-phenylcyclobut-3-ene-1,2-dione.
| Compound Name | 3-(3-fluoroanilino)-4-phenylcyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 22550367 |
| Molecular Formula | C16H10FNO2 |
| Molecular Weight | 267.26 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 3-(3-fluoroanilino)-4-phenylcyclobut-3-ene-1,2-dione |
| SMILES | O=c1c(Nc2cccc(F)c2)c(-c2ccccc2)c1=O |
| InChI | InChI=1S/C16H10FNO2/c17-11-7-4-8-12(9-11)18-14-13(15(19)16(14)20)10-5-2-1-3-6-10/h1-9,18H |
| InChIKey | NXXXJPREHFFJTG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.26 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|