C22H16FN3 — CID 827706
N-(3-fluorophenyl)-2,6-diphenylpyrimidin-4-amine (PubChem CID 827706) has the molecular formula C22H16FN3 and a molecular weight of 341.39 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2,6-diphenylpyrimidin-4-amine.
| Compound Name | N-(3-fluorophenyl)-2,6-diphenylpyrimidin-4-amine |
|---|---|
| PubChem CID | 827706 |
| Molecular Formula | C22H16FN3 |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | N-(3-fluorophenyl)-2,6-diphenylpyrimidin-4-amine |
| SMILES | Fc1cccc(Nc2cc(-c3ccccc3)nc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C22H16FN3/c23-18-12-7-13-19(14-18)24-21-15-20(16-8-3-1-4-9-16)25-22(26-21)17-10-5-2-6-11-17/h1-15H,(H,24,25,26) |
| InChIKey | OHEJVZGORLMCTL-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |