C22H17N3S — CID 70841690
4-[(2,6-diphenylpyrimidin-4-yl)amino]benzenethiol (PubChem CID 70841690) has the molecular formula C22H17N3S and a molecular weight of 355.47 g/mol. Its IUPAC name is 4-[(2,6-diphenylpyrimidin-4-yl)amino]benzenethiol.
| Compound Name | 4-[(2,6-diphenylpyrimidin-4-yl)amino]benzenethiol |
|---|---|
| PubChem CID | 70841690 |
| Molecular Formula | C22H17N3S |
| Molecular Weight | 355.47 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 4-[(2,6-diphenylpyrimidin-4-yl)amino]benzenethiol |
| SMILES | Sc1ccc(Nc2cc(-c3ccccc3)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C22H17N3S/c26-19-13-11-18(12-14-19)23-21-15-20(16-7-3-1-4-8-16)24-22(25-21)17-9-5-2-6-10-17/h1-15,26H,(H,23,24,25) |
| InChIKey | VHNGHSOTDCNDJB-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.47 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|