C20H15N5 — CID 4273597
6-phenyl-N,2-dipyridin-4-ylpyrimidin-4-amine (PubChem CID 4273597) has the molecular formula C20H15N5 and a molecular weight of 325.38 g/mol. Its IUPAC name is 6-phenyl-N,2-dipyridin-4-ylpyrimidin-4-amine.
| Compound Name | 6-phenyl-N,2-dipyridin-4-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 4273597 |
| Molecular Formula | C20H15N5 |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 6-phenyl-N,2-dipyridin-4-ylpyrimidin-4-amine |
| SMILES | c1ccc(-c2cc(Nc3ccncc3)nc(-c3ccncc3)n2)cc1 |
| InChI | InChI=1S/C20H15N5/c1-2-4-15(5-3-1)18-14-19(23-17-8-12-22-13-9-17)25-20(24-18)16-6-10-21-11-7-16/h1-14H,(H,22,23,24,25) |
| InChIKey | LARURDMAOYMBJZ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |