C17H13FN2O3 — CID 110493178
(E)-3-(3-fluorophenyl)-N-(3-oxo-4H-1,4-benzoxazin-7-yl)prop-2-enamide (PubChem CID 110493178) has the molecular formula C17H13FN2O3 and a molecular weight of 312.30 g/mol. Its IUPAC name is (E)-3-(3-fluorophenyl)-N-(3-oxo-4H-1,4-benzoxazin-7-yl)prop-2-enamide.
| Compound Name | (E)-3-(3-fluorophenyl)-N-(3-oxo-4H-1,4-benzoxazin-7-yl)prop-2-enamide |
|---|---|
| PubChem CID | 110493178 |
| Molecular Formula | C17H13FN2O3 |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | (E)-3-(3-fluorophenyl)-N-(3-oxo-4H-1,4-benzoxazin-7-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cccc(F)c1)Nc1ccc2c(c1)OCC(=O)N2 |
| InChI | InChI=1S/C17H13FN2O3/c18-12-3-1-2-11(8-12)4-7-16(21)19-13-5-6-14-15(9-13)23-10-17(22)20-14/h1-9H,10H2,(H,19,21)(H,20,22)/b7-4+ |
| InChIKey | CDZUWPRKBHDZGW-QPJJXVBHSA-N |
| XLogP | 2.81 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|