C23H17FN2O4 — CID 6219773
N-(1,3-benzodioxol-5-yl)-2-[[(E)-3-(3-fluorophenyl)prop-2-enoyl]amino]benzamide (PubChem CID 6219773) has the molecular formula C23H17FN2O4 and a molecular weight of 404.40 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-[[(E)-3-(3-fluorophenyl)prop-2-enoyl]amino]benzamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-[[(E)-3-(3-fluorophenyl)prop-2-enoyl]amino]benzamide |
|---|---|
| PubChem CID | 6219773 |
| Molecular Formula | C23H17FN2O4 |
| Molecular Weight | 404.40 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-[[(E)-3-(3-fluorophenyl)prop-2-enoyl]amino]benzamide |
| SMILES | O=C(/C=C/c1cccc(F)c1)Nc1ccccc1C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H17FN2O4/c24-16-5-3-4-15(12-16)8-11-22(27)26-19-7-2-1-6-18(19)23(28)25-17-9-10-20-21(13-17)30-14-29-20/h1-13H,14H2,(H,25,28)(H,26,27)/b11-8+ |
| InChIKey | ZKTZFIYEDBGJHI-DHZHZOJOSA-N |
| XLogP | 4.46 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.40 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|