C19H17NO5 — CID 40616237
methyl 3-[[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]amino]-2-methylbenzoate (PubChem CID 40616237) has the molecular formula C19H17NO5 and a molecular weight of 339.35 g/mol. Its IUPAC name is methyl 3-[[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]amino]-2-methylbenzoate.
| Compound Name | methyl 3-[[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]amino]-2-methylbenzoate |
|---|---|
| PubChem CID | 40616237 |
| Molecular Formula | C19H17NO5 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | methyl 3-[[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]amino]-2-methylbenzoate |
| SMILES | COC(=O)c1cccc(NC(=O)/C=C/c2ccc3c(c2)OCO3)c1C |
| InChI | InChI=1S/C19H17NO5/c1-12-14(19(22)23-2)4-3-5-15(12)20-18(21)9-7-13-6-8-16-17(10-13)25-11-24-16/h3-10H,11H2,1-2H3,(H,20,21)/b9-7+ |
| InChIKey | MLGLPMBYSNTQLQ-VQHVLOKHSA-N |
| XLogP | 3.16 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|