C18H14F2N2O4 — CID 51153400
(E)-3-[4-(difluoromethoxy)phenyl]-N-(3-oxo-4H-1,4-benzoxazin-6-yl)prop-2-enamide (PubChem CID 51153400) has the molecular formula C18H14F2N2O4 and a molecular weight of 360.32 g/mol. Its IUPAC name is (E)-3-[4-(difluoromethoxy)phenyl]-N-(3-oxo-4H-1,4-benzoxazin-6-yl)prop-2-enamide.
| Compound Name | (E)-3-[4-(difluoromethoxy)phenyl]-N-(3-oxo-4H-1,4-benzoxazin-6-yl)prop-2-enamide |
|---|---|
| PubChem CID | 51153400 |
| Molecular Formula | C18H14F2N2O4 |
| Molecular Weight | 360.32 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | (E)-3-[4-(difluoromethoxy)phenyl]-N-(3-oxo-4H-1,4-benzoxazin-6-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(OC(F)F)cc1)Nc1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C18H14F2N2O4/c19-18(20)26-13-5-1-11(2-6-13)3-8-16(23)21-12-4-7-15-14(9-12)22-17(24)10-25-15/h1-9,18H,10H2,(H,21,23)(H,22,24)/b8-3+ |
| InChIKey | TVKXAKMKKWRXRJ-FPYGCLRLSA-N |
| XLogP | 3.27 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|