C15H12N2O3S — CID 51153507
(E)-N-(3-oxo-4H-1,4-benzoxazin-6-yl)-3-thiophen-2-ylprop-2-enamide (PubChem CID 51153507) has the molecular formula C15H12N2O3S and a molecular weight of 300.34 g/mol. Its IUPAC name is (E)-N-(3-oxo-4H-1,4-benzoxazin-6-yl)-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-(3-oxo-4H-1,4-benzoxazin-6-yl)-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 51153507 |
| Molecular Formula | C15H12N2O3S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | (E)-N-(3-oxo-4H-1,4-benzoxazin-6-yl)-3-thiophen-2-ylprop-2-enamide |
| SMILES | O=C(/C=C/c1cccs1)Nc1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C15H12N2O3S/c18-14(6-4-11-2-1-7-21-11)16-10-3-5-13-12(8-10)17-15(19)9-20-13/h1-8H,9H2,(H,16,18)(H,17,19)/b6-4+ |
| InChIKey | OJXPLANISGOFJN-GQCTYLIASA-N |
| XLogP | 2.73 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|