C14H11N3O4 — CID 59802793
6-oxo-N-(3-oxo-4H-1,4-benzoxazin-7-yl)-1H-pyridine-2-carboxamide (PubChem CID 59802793) has the molecular formula C14H11N3O4 and a molecular weight of 285.26 g/mol. Its IUPAC name is 6-oxo-N-(3-oxo-4H-1,4-benzoxazin-7-yl)-1H-pyridine-2-carboxamide.
| Compound Name | 6-oxo-N-(3-oxo-4H-1,4-benzoxazin-7-yl)-1H-pyridine-2-carboxamide |
|---|---|
| PubChem CID | 59802793 |
| Molecular Formula | C14H11N3O4 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 6-oxo-N-(3-oxo-4H-1,4-benzoxazin-7-yl)-1H-pyridine-2-carboxamide |
| SMILES | O=C1COc2cc(NC(=O)c3cccc(=O)[nH]3)ccc2N1 |
| InChI | InChI=1S/C14H11N3O4/c18-12-3-1-2-10(17-12)14(20)15-8-4-5-9-11(6-8)21-7-13(19)16-9/h1-6H,7H2,(H,15,20)(H,16,19)(H,17,18) |
| InChIKey | BKORQAPCNGSRRH-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |