C13H10N2O3S — CID 59802926
N-(3-oxo-4H-1,4-benzoxazin-7-yl)thiophene-3-carboxamide (PubChem CID 59802926) has the molecular formula C13H10N2O3S and a molecular weight of 274.30 g/mol. Its IUPAC name is N-(3-oxo-4H-1,4-benzoxazin-7-yl)thiophene-3-carboxamide.
| Compound Name | N-(3-oxo-4H-1,4-benzoxazin-7-yl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 59802926 |
| Molecular Formula | C13H10N2O3S |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | N-(3-oxo-4H-1,4-benzoxazin-7-yl)thiophene-3-carboxamide |
| SMILES | O=C1COc2cc(NC(=O)c3ccsc3)ccc2N1 |
| InChI | InChI=1S/C13H10N2O3S/c16-12-6-18-11-5-9(1-2-10(11)15-12)14-13(17)8-3-4-19-7-8/h1-5,7H,6H2,(H,14,17)(H,15,16) |
| InChIKey | SAHLCCFSPHFVJC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |