C15H14N2O3S — CID 52904693
N-(4-ethyl-3-oxo-1,4-benzoxazin-6-yl)thiophene-3-carboxamide (PubChem CID 52904693) has the molecular formula C15H14N2O3S and a molecular weight of 302.36 g/mol. Its IUPAC name is N-(4-ethyl-3-oxo-1,4-benzoxazin-6-yl)thiophene-3-carboxamide.
| Compound Name | N-(4-ethyl-3-oxo-1,4-benzoxazin-6-yl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 52904693 |
| Molecular Formula | C15H14N2O3S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | N-(4-ethyl-3-oxo-1,4-benzoxazin-6-yl)thiophene-3-carboxamide |
| SMILES | CCN1C(=O)COc2ccc(NC(=O)c3ccsc3)cc21 |
| InChI | InChI=1S/C15H14N2O3S/c1-2-17-12-7-11(3-4-13(12)20-8-14(17)18)16-15(19)10-5-6-21-9-10/h3-7,9H,2,8H2,1H3,(H,16,19) |
| InChIKey | SUBWNQFKPAPEMP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |