C19H22N4O3 — CID 118782796
1-(4-ethyl-3-oxo-1,4-benzoxazin-6-yl)-3-(3-pyridin-2-ylpropyl)urea (PubChem CID 118782796) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is 1-(4-ethyl-3-oxo-1,4-benzoxazin-6-yl)-3-(3-pyridin-2-ylpropyl)urea.
| Compound Name | 1-(4-ethyl-3-oxo-1,4-benzoxazin-6-yl)-3-(3-pyridin-2-ylpropyl)urea |
|---|---|
| PubChem CID | 118782796 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 1-(4-ethyl-3-oxo-1,4-benzoxazin-6-yl)-3-(3-pyridin-2-ylpropyl)urea |
| SMILES | CCN1C(=O)COc2ccc(NC(=O)NCCCc3ccccn3)cc21 |
| InChI | InChI=1S/C19H22N4O3/c1-2-23-16-12-15(8-9-17(16)26-13-18(23)24)22-19(25)21-11-5-7-14-6-3-4-10-20-14/h3-4,6,8-10,12H,2,5,7,11,13H2,1H3,(H2,21,22,25) |
| InChIKey | DUSDFCTXICXHBS-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|