C16H19N5O3 — CID 118776043
1-(4-ethyl-3-oxo-1,4-benzoxazin-6-yl)-3-[2-(1H-imidazol-5-yl)ethyl]urea (PubChem CID 118776043) has the molecular formula C16H19N5O3 and a molecular weight of 329.36 g/mol. Its IUPAC name is 1-(4-ethyl-3-oxo-1,4-benzoxazin-6-yl)-3-[2-(1H-imidazol-5-yl)ethyl]urea.
| Compound Name | 1-(4-ethyl-3-oxo-1,4-benzoxazin-6-yl)-3-[2-(1H-imidazol-5-yl)ethyl]urea |
|---|---|
| PubChem CID | 118776043 |
| Molecular Formula | C16H19N5O3 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 1-(4-ethyl-3-oxo-1,4-benzoxazin-6-yl)-3-[2-(1H-imidazol-5-yl)ethyl]urea |
| SMILES | CCN1C(=O)COc2ccc(NC(=O)NCCc3cnc[nH]3)cc21 |
| InChI | InChI=1S/C16H19N5O3/c1-2-21-13-7-11(3-4-14(13)24-9-15(21)22)20-16(23)18-6-5-12-8-17-10-19-12/h3-4,7-8,10H,2,5-6,9H2,1H3,(H,17,19)(H2,18,20,23) |
| InChIKey | AKSZINLPZGOIKS-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |