C12H13FN4O — CID 65231550
1-(3-fluorophenyl)-3-[2-(1H-imidazol-5-yl)ethyl]urea (PubChem CID 65231550) has the molecular formula C12H13FN4O and a molecular weight of 248.26 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-3-[2-(1H-imidazol-5-yl)ethyl]urea.
| Compound Name | 1-(3-fluorophenyl)-3-[2-(1H-imidazol-5-yl)ethyl]urea |
|---|---|
| PubChem CID | 65231550 |
| Molecular Formula | C12H13FN4O |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 1-(3-fluorophenyl)-3-[2-(1H-imidazol-5-yl)ethyl]urea |
| SMILES | O=C(NCCc1cnc[nH]1)Nc1cccc(F)c1 |
| InChI | InChI=1S/C12H13FN4O/c13-9-2-1-3-10(6-9)17-12(18)15-5-4-11-7-14-8-16-11/h1-3,6-8H,4-5H2,(H,14,16)(H2,15,17,18) |
| InChIKey | ISAYNKUZWXPUNM-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |