C16H19FN4O — CID 134359780
1-[2-[(3,5-dimethyl-4-pyridinyl)amino]ethyl]-3-(3-fluorophenyl)urea (PubChem CID 134359780) has the molecular formula C16H19FN4O and a molecular weight of 302.35 g/mol. Its IUPAC name is 1-[2-[(3,5-dimethyl-4-pyridinyl)amino]ethyl]-3-(3-fluorophenyl)urea.
| Compound Name | 1-[2-[(3,5-dimethyl-4-pyridinyl)amino]ethyl]-3-(3-fluorophenyl)urea |
|---|---|
| PubChem CID | 134359780 |
| Molecular Formula | C16H19FN4O |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 1-[2-[(3,5-dimethyl-4-pyridinyl)amino]ethyl]-3-(3-fluorophenyl)urea |
| SMILES | Cc1cncc(C)c1NCCNC(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C16H19FN4O/c1-11-9-18-10-12(2)15(11)19-6-7-20-16(22)21-14-5-3-4-13(17)8-14/h3-5,8-10H,6-7H2,1-2H3,(H,18,19)(H2,20,21,22) |
| InChIKey | SFVLSEPJTZBTKL-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|