C20H18FN5O — CID 43813654
1-[2-[(3-cyano-8-methylquinolin-2-yl)amino]ethyl]-3-(3-fluorophenyl)urea (PubChem CID 43813654) has the molecular formula C20H18FN5O and a molecular weight of 363.40 g/mol. Its IUPAC name is 1-[2-[(3-cyano-8-methylquinolin-2-yl)amino]ethyl]-3-(3-fluorophenyl)urea.
| Compound Name | 1-[2-[(3-cyano-8-methylquinolin-2-yl)amino]ethyl]-3-(3-fluorophenyl)urea |
|---|---|
| PubChem CID | 43813654 |
| Molecular Formula | C20H18FN5O |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 1-[2-[(3-cyano-8-methylquinolin-2-yl)amino]ethyl]-3-(3-fluorophenyl)urea |
| SMILES | Cc1cccc2cc(C#N)c(NCCNC(=O)Nc3cccc(F)c3)nc12 |
| InChI | InChI=1S/C20H18FN5O/c1-13-4-2-5-14-10-15(12-22)19(26-18(13)14)23-8-9-24-20(27)25-17-7-3-6-16(21)11-17/h2-7,10-11H,8-9H2,1H3,(H,23,26)(H2,24,25,27) |
| InChIKey | AIZDNESBXFPOGX-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 89.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|