C22H22ClN5O — CID 43815044
1-(2-chlorophenyl)-3-[3-[(3-cyano-6,8-dimethylquinolin-2-yl)amino]propyl]urea (PubChem CID 43815044) has the molecular formula C22H22ClN5O and a molecular weight of 407.91 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-[3-[(3-cyano-6,8-dimethylquinolin-2-yl)amino]propyl]urea.
| Compound Name | 1-(2-chlorophenyl)-3-[3-[(3-cyano-6,8-dimethylquinolin-2-yl)amino]propyl]urea |
|---|---|
| PubChem CID | 43815044 |
| Molecular Formula | C22H22ClN5O |
| Molecular Weight | 407.91 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 1-(2-chlorophenyl)-3-[3-[(3-cyano-6,8-dimethylquinolin-2-yl)amino]propyl]urea |
| SMILES | Cc1cc(C)c2nc(NCCCNC(=O)Nc3ccccc3Cl)c(C#N)cc2c1 |
| InChI | InChI=1S/C22H22ClN5O/c1-14-10-15(2)20-16(11-14)12-17(13-24)21(28-20)25-8-5-9-26-22(29)27-19-7-4-3-6-18(19)23/h3-4,6-7,10-12H,5,8-9H2,1-2H3,(H,25,28)(H2,26,27,29) |
| InChIKey | DJBNOPGPJRCKDP-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 89.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.91 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|