C21H20ClN5S — CID 43815291
1-(2-chlorophenyl)-3-[2-[(3-cyano-6-ethylquinolin-2-yl)amino]ethyl]thiourea (PubChem CID 43815291) has the molecular formula C21H20ClN5S and a molecular weight of 409.95 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-[2-[(3-cyano-6-ethylquinolin-2-yl)amino]ethyl]thiourea.
| Compound Name | 1-(2-chlorophenyl)-3-[2-[(3-cyano-6-ethylquinolin-2-yl)amino]ethyl]thiourea |
|---|---|
| PubChem CID | 43815291 |
| Molecular Formula | C21H20ClN5S |
| Molecular Weight | 409.95 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | 1-(2-chlorophenyl)-3-[2-[(3-cyano-6-ethylquinolin-2-yl)amino]ethyl]thiourea |
| SMILES | CCc1ccc2nc(NCCNC(=S)Nc3ccccc3Cl)c(C#N)cc2c1 |
| InChI | InChI=1S/C21H20ClN5S/c1-2-14-7-8-18-15(11-14)12-16(13-23)20(26-18)24-9-10-25-21(28)27-19-6-4-3-5-17(19)22/h3-8,11-12H,2,9-10H2,1H3,(H,24,26)(H2,25,27,28) |
| InChIKey | OQYBHNLJWXNGGZ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 72.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.95 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|