C23H25N5S — CID 43815170
1-[2-[(3-cyano-6-ethylquinolin-2-yl)amino]ethyl]-3-(2,4-dimethylphenyl)thiourea (PubChem CID 43815170) has the molecular formula C23H25N5S and a molecular weight of 403.56 g/mol. Its IUPAC name is 1-[2-[(3-cyano-6-ethylquinolin-2-yl)amino]ethyl]-3-(2,4-dimethylphenyl)thiourea.
| Compound Name | 1-[2-[(3-cyano-6-ethylquinolin-2-yl)amino]ethyl]-3-(2,4-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 43815170 |
| Molecular Formula | C23H25N5S |
| Molecular Weight | 403.56 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 1-[2-[(3-cyano-6-ethylquinolin-2-yl)amino]ethyl]-3-(2,4-dimethylphenyl)thiourea |
| SMILES | CCc1ccc2nc(NCCNC(=S)Nc3ccc(C)cc3C)c(C#N)cc2c1 |
| InChI | InChI=1S/C23H25N5S/c1-4-17-6-8-21-18(12-17)13-19(14-24)22(27-21)25-9-10-26-23(29)28-20-7-5-15(2)11-16(20)3/h5-8,11-13H,4,9-10H2,1-3H3,(H,25,27)(H2,26,28,29) |
| InChIKey | IZPXZTWBTVXHTR-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 72.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.56 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|