C15H13F3N4O — CID 3288463
N-[2-[(3-cyano-7-methylquinolin-2-yl)amino]ethyl]-2,2,2-trifluoroacetamide (PubChem CID 3288463) has the molecular formula C15H13F3N4O and a molecular weight of 322.29 g/mol. Its IUPAC name is N-[2-[(3-cyano-7-methylquinolin-2-yl)amino]ethyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[2-[(3-cyano-7-methylquinolin-2-yl)amino]ethyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 3288463 |
| Molecular Formula | C15H13F3N4O |
| Molecular Weight | 322.29 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | N-[2-[(3-cyano-7-methylquinolin-2-yl)amino]ethyl]-2,2,2-trifluoroacetamide |
| SMILES | Cc1ccc2cc(C#N)c(NCCNC(=O)C(F)(F)F)nc2c1 |
| InChI | InChI=1S/C15H13F3N4O/c1-9-2-3-10-7-11(8-19)13(22-12(10)6-9)20-4-5-21-14(23)15(16,17)18/h2-3,6-7H,4-5H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | YEGXAXHNMQFPEM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|