C19H22N4O2 — CID 7434796
(2R)-N-[2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl]oxolane-2-carboxamide (PubChem CID 7434796) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is (2R)-N-[2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl]oxolane-2-carboxamide.
| Compound Name | (2R)-N-[2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 7434796 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | (2R)-N-[2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl]oxolane-2-carboxamide |
| SMILES | Cc1cc(C)c2cc(C#N)c(NCCNC(=O)[C@H]3CCCO3)nc2c1 |
| InChI | InChI=1S/C19H22N4O2/c1-12-8-13(2)15-10-14(11-20)18(23-16(15)9-12)21-5-6-22-19(24)17-4-3-7-25-17/h8-10,17H,3-7H2,1-2H3,(H,21,23)(H,22,24)/t17-/m1/s1 |
| InChIKey | BZKVBGCXZJAQJA-QGZVFWFLSA-N |
| XLogP | 2.43 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|