C22H21F2N5O — CID 43815089
1-[3-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]propyl]-3-(2,4-difluorophenyl)urea (PubChem CID 43815089) has the molecular formula C22H21F2N5O and a molecular weight of 409.44 g/mol. Its IUPAC name is 1-[3-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]propyl]-3-(2,4-difluorophenyl)urea.
| Compound Name | 1-[3-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]propyl]-3-(2,4-difluorophenyl)urea |
|---|---|
| PubChem CID | 43815089 |
| Molecular Formula | C22H21F2N5O |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | 1-[3-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]propyl]-3-(2,4-difluorophenyl)urea |
| SMILES | Cc1cc(C)c2cc(C#N)c(NCCCNC(=O)Nc3ccc(F)cc3F)nc2c1 |
| InChI | InChI=1S/C22H21F2N5O/c1-13-8-14(2)17-10-15(12-25)21(28-20(17)9-13)26-6-3-7-27-22(30)29-19-5-4-16(23)11-18(19)24/h4-5,8-11H,3,6-7H2,1-2H3,(H,26,28)(H2,27,29,30) |
| InChIKey | XBAPAXFQAGHXIG-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 89.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|