C17H20N4O — CID 3221711
N-[2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl]propanamide (PubChem CID 3221711) has the molecular formula C17H20N4O and a molecular weight of 296.37 g/mol. Its IUPAC name is N-[2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl]propanamide.
| Compound Name | N-[2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl]propanamide |
|---|---|
| PubChem CID | 3221711 |
| Molecular Formula | C17H20N4O |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | N-[2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl]propanamide |
| SMILES | CCC(=O)NCCNc1nc2cc(C)cc(C)c2cc1C#N |
| InChI | InChI=1S/C17H20N4O/c1-4-16(22)19-5-6-20-17-13(10-18)9-14-12(3)7-11(2)8-15(14)21-17/h7-9H,4-6H2,1-3H3,(H,19,22)(H,20,21) |
| InChIKey | PJJAUJKDOPWQDR-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|