C22H20F2N4O — CID 3221738
N-[3-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]propyl]-2,6-difluorobenzamide (PubChem CID 3221738) has the molecular formula C22H20F2N4O and a molecular weight of 394.43 g/mol. Its IUPAC name is N-[3-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]propyl]-2,6-difluorobenzamide.
| Compound Name | N-[3-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]propyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 3221738 |
| Molecular Formula | C22H20F2N4O |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | N-[3-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]propyl]-2,6-difluorobenzamide |
| SMILES | Cc1cc(C)c2cc(C#N)c(NCCCNC(=O)c3c(F)cccc3F)nc2c1 |
| InChI | InChI=1S/C22H20F2N4O/c1-13-9-14(2)16-11-15(12-25)21(28-19(16)10-13)26-7-4-8-27-22(29)20-17(23)5-3-6-18(20)24/h3,5-6,9-11H,4,7-8H2,1-2H3,(H,26,28)(H,27,29) |
| InChIKey | UOZUDHUPJDQBOM-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|