C22H20F2N4O2 — CID 3288689
N-[3-[(3-cyano-6-ethoxyquinolin-2-yl)amino]propyl]-3,4-difluorobenzamide (PubChem CID 3288689) has the molecular formula C22H20F2N4O2 and a molecular weight of 410.42 g/mol. Its IUPAC name is N-[3-[(3-cyano-6-ethoxyquinolin-2-yl)amino]propyl]-3,4-difluorobenzamide.
| Compound Name | N-[3-[(3-cyano-6-ethoxyquinolin-2-yl)amino]propyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 3288689 |
| Molecular Formula | C22H20F2N4O2 |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | N-[3-[(3-cyano-6-ethoxyquinolin-2-yl)amino]propyl]-3,4-difluorobenzamide |
| SMILES | CCOc1ccc2nc(NCCCNC(=O)c3ccc(F)c(F)c3)c(C#N)cc2c1 |
| InChI | InChI=1S/C22H20F2N4O2/c1-2-30-17-5-7-20-15(11-17)10-16(13-25)21(28-20)26-8-3-9-27-22(29)14-4-6-18(23)19(24)12-14/h4-7,10-12H,2-3,8-9H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | QLEXWHMFZBFHCS-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|