C22H20N4O4 — CID 43815529
N-[2-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)amino]ethyl]-4-ethoxybenzamide (PubChem CID 43815529) has the molecular formula C22H20N4O4 and a molecular weight of 404.43 g/mol. Its IUPAC name is N-[2-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)amino]ethyl]-4-ethoxybenzamide.
| Compound Name | N-[2-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)amino]ethyl]-4-ethoxybenzamide |
|---|---|
| PubChem CID | 43815529 |
| Molecular Formula | C22H20N4O4 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | N-[2-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)amino]ethyl]-4-ethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)NCCNc2nc3cc4c(cc3cc2C#N)OCO4)cc1 |
| InChI | InChI=1S/C22H20N4O4/c1-2-28-17-5-3-14(4-6-17)22(27)25-8-7-24-21-16(12-23)9-15-10-19-20(30-13-29-19)11-18(15)26-21/h3-6,9-11H,2,7-8,13H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | JBKFBWDHQPRYFM-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 105.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|