C20H17N5O2S — CID 43815145
1-[2-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)amino]ethyl]-3-phenylthiourea (PubChem CID 43815145) has the molecular formula C20H17N5O2S and a molecular weight of 391.46 g/mol. Its IUPAC name is 1-[2-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)amino]ethyl]-3-phenylthiourea.
| Compound Name | 1-[2-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)amino]ethyl]-3-phenylthiourea |
|---|---|
| PubChem CID | 43815145 |
| Molecular Formula | C20H17N5O2S |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 1-[2-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)amino]ethyl]-3-phenylthiourea |
| SMILES | N#Cc1cc2cc3c(cc2nc1NCCNC(=S)Nc1ccccc1)OCO3 |
| InChI | InChI=1S/C20H17N5O2S/c21-11-14-8-13-9-17-18(27-12-26-17)10-16(13)25-19(14)22-6-7-23-20(28)24-15-4-2-1-3-5-15/h1-5,8-10H,6-7,12H2,(H,22,25)(H2,23,24,28) |
| InChIKey | AEQBLVKKLXFNLX-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|