C20H17FN4O4S — CID 43815362
N-[3-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)amino]propyl]-4-fluorobenzenesulfonamide (PubChem CID 43815362) has the molecular formula C20H17FN4O4S and a molecular weight of 428.45 g/mol. Its IUPAC name is N-[3-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)amino]propyl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[3-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)amino]propyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 43815362 |
| Molecular Formula | C20H17FN4O4S |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | N-[3-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)amino]propyl]-4-fluorobenzenesulfonamide |
| SMILES | N#Cc1cc2cc3c(cc2nc1NCCCNS(=O)(=O)c1ccc(F)cc1)OCO3 |
| InChI | InChI=1S/C20H17FN4O4S/c21-15-2-4-16(5-3-15)30(26,27)24-7-1-6-23-20-14(11-22)8-13-9-18-19(29-12-28-18)10-17(13)25-20/h2-5,8-10,24H,1,6-7,12H2,(H,23,25) |
| InChIKey | WVZGRVNOEFBDPU-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 113.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|