C15H9FN2O2 — CID 50901206
6-(4-fluorophenyl)-[1,3]dioxolo[4,5-g]quinazoline (PubChem CID 50901206) has the molecular formula C15H9FN2O2 and a molecular weight of 268.25 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-[1,3]dioxolo[4,5-g]quinazoline.
| Compound Name | 6-(4-fluorophenyl)-[1,3]dioxolo[4,5-g]quinazoline |
|---|---|
| PubChem CID | 50901206 |
| Molecular Formula | C15H9FN2O2 |
| Molecular Weight | 268.25 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 6-(4-fluorophenyl)-[1,3]dioxolo[4,5-g]quinazoline |
| SMILES | Fc1ccc(-c2ncc3cc4c(cc3n2)OCO4)cc1 |
| InChI | InChI=1S/C15H9FN2O2/c16-11-3-1-9(2-4-11)15-17-7-10-5-13-14(20-8-19-13)6-12(10)18-15/h1-7H,8H2 |
| InChIKey | JWXKWPFXSHEQOB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.25 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |