C15H10N2O2 — CID 39776102
2-(1,3-benzodioxol-5-yl)quinoxaline (PubChem CID 39776102) has the molecular formula C15H10N2O2 and a molecular weight of 250.26 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)quinoxaline.
| Compound Name | 2-(1,3-benzodioxol-5-yl)quinoxaline |
|---|---|
| PubChem CID | 39776102 |
| Molecular Formula | C15H10N2O2 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)quinoxaline |
| SMILES | c1ccc2nc(-c3ccc4c(c3)OCO4)cnc2c1 |
| InChI | InChI=1S/C15H10N2O2/c1-2-4-12-11(3-1)16-8-13(17-12)10-5-6-14-15(7-10)19-9-18-14/h1-8H,9H2 |
| InChIKey | YALFPXMVZCUZHX-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |