C24H19N3O4 — CID 53112175
N-(1,3-benzodioxol-5-ylmethyl)-2-(4-quinoxalin-2-ylphenoxy)acetamide (PubChem CID 53112175) has the molecular formula C24H19N3O4 and a molecular weight of 413.43 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-(4-quinoxalin-2-ylphenoxy)acetamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-(4-quinoxalin-2-ylphenoxy)acetamide |
|---|---|
| PubChem CID | 53112175 |
| Molecular Formula | C24H19N3O4 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-(4-quinoxalin-2-ylphenoxy)acetamide |
| SMILES | O=C(COc1ccc(-c2cnc3ccccc3n2)cc1)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H19N3O4/c28-24(26-12-16-5-10-22-23(11-16)31-15-30-22)14-29-18-8-6-17(7-9-18)21-13-25-19-3-1-2-4-20(19)27-21/h1-11,13H,12,14-15H2,(H,26,28) |
| InChIKey | JAVTXBWMMLETAG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |