C20H23NO4 — CID 721824
N-(1,3-benzodioxol-5-ylmethyl)-2-(4-tert-butylphenoxy)acetamide (PubChem CID 721824) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-(4-tert-butylphenoxy)acetamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-(4-tert-butylphenoxy)acetamide |
|---|---|
| PubChem CID | 721824 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-(4-tert-butylphenoxy)acetamide |
| SMILES | CC(C)(C)c1ccc(OCC(=O)NCc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C20H23NO4/c1-20(2,3)15-5-7-16(8-6-15)23-12-19(22)21-11-14-4-9-17-18(10-14)25-13-24-17/h4-10H,11-13H2,1-3H3,(H,21,22) |
| InChIKey | WHGVDKPPZAMWAF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |