C12H9ClN2O2 — CID 116899243
4-(1,3-benzodioxol-5-yl)-2-(chloromethyl)pyrimidine (PubChem CID 116899243) has the molecular formula C12H9ClN2O2 and a molecular weight of 248.67 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-2-(chloromethyl)pyrimidine.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-2-(chloromethyl)pyrimidine |
|---|---|
| PubChem CID | 116899243 |
| Molecular Formula | C12H9ClN2O2 |
| Molecular Weight | 248.67 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-2-(chloromethyl)pyrimidine |
| SMILES | ClCc1nccc(-c2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C12H9ClN2O2/c13-6-12-14-4-3-9(15-12)8-1-2-10-11(5-8)17-7-16-10/h1-5H,6-7H2 |
| InChIKey | MYNAUZBIBPPSBK-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.67 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|