C13H11ClN2O2 — CID 79072757
2-chloro-4-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pyrimidine (PubChem CID 79072757) has the molecular formula C13H11ClN2O2 and a molecular weight of 262.70 g/mol. Its IUPAC name is 2-chloro-4-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pyrimidine.
| Compound Name | 2-chloro-4-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pyrimidine |
|---|---|
| PubChem CID | 79072757 |
| Molecular Formula | C13H11ClN2O2 |
| Molecular Weight | 262.70 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 2-chloro-4-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pyrimidine |
| SMILES | Clc1nccc(-c2ccc3c(c2)OCCCO3)n1 |
| InChI | InChI=1S/C13H11ClN2O2/c14-13-15-5-4-10(16-13)9-2-3-11-12(8-9)18-7-1-6-17-11/h2-5,8H,1,6-7H2 |
| InChIKey | NDKPQGSLQAEVCR-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.70 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |