C12H10N2O3 — CID 116903746
4-(1,3-benzodioxol-5-yl)-2-methoxypyrimidine (PubChem CID 116903746) has the molecular formula C12H10N2O3 and a molecular weight of 230.22 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-2-methoxypyrimidine.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-2-methoxypyrimidine |
|---|---|
| PubChem CID | 116903746 |
| Molecular Formula | C12H10N2O3 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-2-methoxypyrimidine |
| SMILES | COc1nccc(-c2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C12H10N2O3/c1-15-12-13-5-4-9(14-12)8-2-3-10-11(6-8)17-7-16-10/h2-6H,7H2,1H3 |
| InChIKey | WIGUIIHBEAJLTR-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |