C19H17NO4 — CID 23296085
3-(1,3-benzodioxol-5-yl)-6,7-dimethoxy-1-methylisoquinoline (PubChem CID 23296085) has the molecular formula C19H17NO4 and a molecular weight of 323.35 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-6,7-dimethoxy-1-methylisoquinoline.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-6,7-dimethoxy-1-methylisoquinoline |
|---|---|
| PubChem CID | 23296085 |
| Molecular Formula | C19H17NO4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-6,7-dimethoxy-1-methylisoquinoline |
| SMILES | COc1cc2cc(-c3ccc4c(c3)OCO4)nc(C)c2cc1OC |
| InChI | InChI=1S/C19H17NO4/c1-11-14-9-18(22-3)17(21-2)8-13(14)6-15(20-11)12-4-5-16-19(7-12)24-10-23-16/h4-9H,10H2,1-3H3 |
| InChIKey | USVVHFFPADGVFN-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |