C21H16O6 — CID 86123002
9-(1,3-benzodioxol-5-yl)-6,7-dimethoxy-3H-benzo[f][1]benzofuran-2-one (PubChem CID 86123002) has the molecular formula C21H16O6 and a molecular weight of 364.35 g/mol. Its IUPAC name is 9-(1,3-benzodioxol-5-yl)-6,7-dimethoxy-3H-benzo[f][1]benzofuran-2-one.
| Compound Name | 9-(1,3-benzodioxol-5-yl)-6,7-dimethoxy-3H-benzo[f][1]benzofuran-2-one |
|---|---|
| PubChem CID | 86123002 |
| Molecular Formula | C21H16O6 |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | 9-(1,3-benzodioxol-5-yl)-6,7-dimethoxy-3H-benzo[f][1]benzofuran-2-one |
| SMILES | COc1cc2cc3c(c(-c4ccc5c(c4)OCO5)c2cc1OC)OC(=O)C3 |
| InChI | InChI=1S/C21H16O6/c1-23-16-7-12-5-13-8-19(22)27-21(13)20(14(12)9-17(16)24-2)11-3-4-15-18(6-11)26-10-25-15/h3-7,9H,8,10H2,1-2H3 |
| InChIKey | GMWLGUKPUHJMNT-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|