C25H21NO9 — CID 139511912
[9-(1,3-benzodioxol-5-yl)-2-(2-hydroxyethyl)-6,7-dimethoxy-1,3-dioxobenzo[f]isoindol-4-yl] acetate (PubChem CID 139511912) has the molecular formula C25H21NO9 and a molecular weight of 479.44 g/mol. Its IUPAC name is [9-(1,3-benzodioxol-5-yl)-2-(2-hydroxyethyl)-6,7-dimethoxy-1,3-dioxobenzo[f]isoindol-4-yl] acetate.
| Compound Name | [9-(1,3-benzodioxol-5-yl)-2-(2-hydroxyethyl)-6,7-dimethoxy-1,3-dioxobenzo[f]isoindol-4-yl] acetate |
|---|---|
| PubChem CID | 139511912 |
| Molecular Formula | C25H21NO9 |
| Molecular Weight | 479.44 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | [9-(1,3-benzodioxol-5-yl)-2-(2-hydroxyethyl)-6,7-dimethoxy-1,3-dioxobenzo[f]isoindol-4-yl] acetate |
| SMILES | COc1cc2c(OC(C)=O)c3c(c(-c4ccc5c(c4)OCO5)c2cc1OC)C(=O)N(CCO)C3=O |
| InChI | InChI=1S/C25H21NO9/c1-12(28)35-23-15-10-18(32-3)17(31-2)9-14(15)20(13-4-5-16-19(8-13)34-11-33-16)21-22(23)25(30)26(6-7-27)24(21)29/h4-5,8-10,27H,6-7,11H2,1-3H3 |
| InChIKey | SJXKMGFCJZSIQW-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 120.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|