C24H19NO7 — CID 46089057
[4-[6-(1,3-benzodioxol-5-yl)-1,3-benzoxazol-2-yl]-2,6-dimethoxyphenyl] acetate (PubChem CID 46089057) has the molecular formula C24H19NO7 and a molecular weight of 433.42 g/mol. Its IUPAC name is [4-[6-(1,3-benzodioxol-5-yl)-1,3-benzoxazol-2-yl]-2,6-dimethoxyphenyl] acetate.
| Compound Name | [4-[6-(1,3-benzodioxol-5-yl)-1,3-benzoxazol-2-yl]-2,6-dimethoxyphenyl] acetate |
|---|---|
| PubChem CID | 46089057 |
| Molecular Formula | C24H19NO7 |
| Molecular Weight | 433.42 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | [4-[6-(1,3-benzodioxol-5-yl)-1,3-benzoxazol-2-yl]-2,6-dimethoxyphenyl] acetate |
| SMILES | COc1cc(-c2nc3ccc(-c4ccc5c(c4)OCO5)cc3o2)cc(OC)c1OC(C)=O |
| InChI | InChI=1S/C24H19NO7/c1-13(26)31-23-21(27-2)10-16(11-22(23)28-3)24-25-17-6-4-14(8-19(17)32-24)15-5-7-18-20(9-15)30-12-29-18/h4-11H,12H2,1-3H3 |
| InChIKey | VXYOEHFLNPXDTJ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 89.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.42 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|