C16H15NO4 — CID 82357784
[2-(3,4-dimethoxyphenyl)-1,3-benzoxazol-6-yl]methanol (PubChem CID 82357784) has the molecular formula C16H15NO4 and a molecular weight of 285.30 g/mol. Its IUPAC name is [2-(3,4-dimethoxyphenyl)-1,3-benzoxazol-6-yl]methanol.
| Compound Name | [2-(3,4-dimethoxyphenyl)-1,3-benzoxazol-6-yl]methanol |
|---|---|
| PubChem CID | 82357784 |
| Molecular Formula | C16H15NO4 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | [2-(3,4-dimethoxyphenyl)-1,3-benzoxazol-6-yl]methanol |
| SMILES | COc1ccc(-c2nc3ccc(CO)cc3o2)cc1OC |
| InChI | InChI=1S/C16H15NO4/c1-19-13-6-4-11(8-15(13)20-2)16-17-12-5-3-10(9-18)7-14(12)21-16/h3-8,18H,9H2,1-2H3 |
| InChIKey | RVEHRBDWBCVFKA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 64.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |