C15H12FNO3 — CID 25034610
2-(3,4-dimethoxyphenyl)-6-fluoro-1,3-benzoxazole (PubChem CID 25034610) has the molecular formula C15H12FNO3 and a molecular weight of 273.26 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-6-fluoro-1,3-benzoxazole.
| Compound Name | 2-(3,4-dimethoxyphenyl)-6-fluoro-1,3-benzoxazole |
|---|---|
| PubChem CID | 25034610 |
| Molecular Formula | C15H12FNO3 |
| Molecular Weight | 273.26 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-6-fluoro-1,3-benzoxazole |
| SMILES | COc1ccc(-c2nc3ccc(F)cc3o2)cc1OC |
| InChI | InChI=1S/C15H12FNO3/c1-18-12-6-3-9(7-14(12)19-2)15-17-11-5-4-10(16)8-13(11)20-15/h3-8H,1-2H3 |
| InChIKey | QVVNPEBJIPHTAY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.26 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |