2-(3,4-dimethoxyphenyl)-1,3-benzoxazole-5-carboxylic acid

C16H13NO5 — CID 11688023

IUPAC2-(3,4-dimethoxyphenyl)-1,3-benzoxazole-5-carboxylic acid
SMILESCOc1ccc(-c2nc3cc(C(=O)O)ccc3o2)cc1OC
InChIInChI=1S/C16H13NO5/c1-20-13-6-3-9(8-14(13)21-2)15-17-11-7-10(16(18)19)4-5-12(11)22-15/h3-8H,1-2H3,(H,18,19)
InChIKeyRMWYFOAAGUCKKT-UHFFFAOYSA-N
MW299.28 g/mol
LogP3.21
Rot. Bonds4

About 2-(3,4-dimethoxyphenyl)-1,3-benzoxazole-5-carboxylic acid

2-(3,4-dimethoxyphenyl)-1,3-benzoxazole-5-carboxylic acid (PubChem CID 11688023) has the molecular formula C16H13NO5 and a molecular weight of 299.28 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-1,3-benzoxazole-5-carboxylic acid.

Molecular Properties

Compound Name2-(3,4-dimethoxyphenyl)-1,3-benzoxazole-5-carboxylic acid
PubChem CID11688023
Molecular FormulaC16H13NO5
Molecular Weight299.28 g/mol
Exact Mass299.08
IUPAC Name2-(3,4-dimethoxyphenyl)-1,3-benzoxazole-5-carboxylic acid
SMILESCOc1ccc(-c2nc3cc(C(=O)O)ccc3o2)cc1OC
InChIInChI=1S/C16H13NO5/c1-20-13-6-3-9(8-14(13)21-2)15-17-11-7-10(16(18)19)4-5-12(11)22-15/h3-8H,1-2H3,(H,18,19)
InChIKeyRMWYFOAAGUCKKT-UHFFFAOYSA-N
XLogP3.21
TPSA81.79 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500299.28
LogP ≤ 53.21
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-(3,4-dimethoxyphenyl)-1,3-benzoxazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,4-dimethoxyphenyl)-1,3-benzoxazole-5-carboxylic acid?
The IUPAC name of 2-(3,4-dimethoxyphenyl)-1,3-benzoxazole-5-carboxylic acid (CID 11688023) is 2-(3,4-dimethoxyphenyl)-1,3-benzoxazole-5-carboxylic acid.
What is the SMILES notation for 2-(3,4-dimethoxyphenyl)-1,3-benzoxazole-5-carboxylic acid?
The canonical SMILES for 2-(3,4-dimethoxyphenyl)-1,3-benzoxazole-5-carboxylic acid is COc1ccc(-c2nc3cc(C(=O)O)ccc3o2)cc1OC.
What is the InChIKey of 2-(3,4-dimethoxyphenyl)-1,3-benzoxazole-5-carboxylic acid?
The InChIKey is RMWYFOAAGUCKKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO5/c1-20-13-6-3-9(8-14(13)21-2)15-17-11-7-10(16(18)19)4-5-12(11)22-15/h3-8H,1-2H3,(H,18,19).
What are the key properties of 2-(3,4-dimethoxyphenyl)-1,3-benzoxazole-5-carboxylic acid?
2-(3,4-dimethoxyphenyl)-1,3-benzoxazole-5-carboxylic acid has a molecular weight of 299.28 g/mol, XLogP of 3.21, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethoxyphenyl)-1,3-benzoxazole-5-carboxylic acid is sourced from PubChem (CID 11688023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).