C16H13NO5 — CID 11688023
2-(3,4-dimethoxyphenyl)-1,3-benzoxazole-5-carboxylic acid (PubChem CID 11688023) has the molecular formula C16H13NO5 and a molecular weight of 299.28 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-1,3-benzoxazole-5-carboxylic acid.
| Compound Name | 2-(3,4-dimethoxyphenyl)-1,3-benzoxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 11688023 |
| Molecular Formula | C16H13NO5 |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-1,3-benzoxazole-5-carboxylic acid |
| SMILES | COc1ccc(-c2nc3cc(C(=O)O)ccc3o2)cc1OC |
| InChI | InChI=1S/C16H13NO5/c1-20-13-6-3-9(8-14(13)21-2)15-17-11-7-10(16(18)19)4-5-12(11)22-15/h3-8H,1-2H3,(H,18,19) |
| InChIKey | RMWYFOAAGUCKKT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 81.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |