C14H6Cl3NO3 — CID 50849557
2-(3,4,5-trichlorophenyl)-1,3-benzoxazole-5-carboxylic acid (PubChem CID 50849557) has the molecular formula C14H6Cl3NO3 and a molecular weight of 342.57 g/mol. Its IUPAC name is 2-(3,4,5-trichlorophenyl)-1,3-benzoxazole-5-carboxylic acid.
| Compound Name | 2-(3,4,5-trichlorophenyl)-1,3-benzoxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 50849557 |
| Molecular Formula | C14H6Cl3NO3 |
| Molecular Weight | 342.57 g/mol |
| Exact Mass | 340.94 |
| IUPAC Name | 2-(3,4,5-trichlorophenyl)-1,3-benzoxazole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2oc(-c3cc(Cl)c(Cl)c(Cl)c3)nc2c1 |
| InChI | InChI=1S/C14H6Cl3NO3/c15-8-3-7(4-9(16)12(8)17)13-18-10-5-6(14(19)20)1-2-11(10)21-13/h1-5H,(H,19,20) |
| InChIKey | BHPUFJGXJAMZRO-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.57 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|