C14H7BrCl2N2O2 — CID 50849580
2-(4-bromo-3,5-dichlorophenyl)-1,3-benzoxazole-5-carboxamide (PubChem CID 50849580) has the molecular formula C14H7BrCl2N2O2 and a molecular weight of 386.03 g/mol. Its IUPAC name is 2-(4-bromo-3,5-dichlorophenyl)-1,3-benzoxazole-5-carboxamide.
| Compound Name | 2-(4-bromo-3,5-dichlorophenyl)-1,3-benzoxazole-5-carboxamide |
|---|---|
| PubChem CID | 50849580 |
| Molecular Formula | C14H7BrCl2N2O2 |
| Molecular Weight | 386.03 g/mol |
| Exact Mass | 383.91 |
| IUPAC Name | 2-(4-bromo-3,5-dichlorophenyl)-1,3-benzoxazole-5-carboxamide |
| SMILES | NC(=O)c1ccc2oc(-c3cc(Cl)c(Br)c(Cl)c3)nc2c1 |
| InChI | InChI=1S/C14H7BrCl2N2O2/c15-12-8(16)3-7(4-9(12)17)14-19-10-5-6(13(18)20)1-2-11(10)21-14/h1-5H,(H2,18,20) |
| InChIKey | OJQKITVIRJMKTD-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.03 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|