C15H10ClNO2 — CID 95474684
1-[2-(2-chlorophenyl)-1,3-benzoxazol-5-yl]ethanone (PubChem CID 95474684) has the molecular formula C15H10ClNO2 and a molecular weight of 271.70 g/mol. Its IUPAC name is 1-[2-(2-chlorophenyl)-1,3-benzoxazol-5-yl]ethanone.
| Compound Name | 1-[2-(2-chlorophenyl)-1,3-benzoxazol-5-yl]ethanone |
|---|---|
| PubChem CID | 95474684 |
| Molecular Formula | C15H10ClNO2 |
| Molecular Weight | 271.70 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 1-[2-(2-chlorophenyl)-1,3-benzoxazol-5-yl]ethanone |
| SMILES | CC(=O)c1ccc2oc(-c3ccccc3Cl)nc2c1 |
| InChI | InChI=1S/C15H10ClNO2/c1-9(18)10-6-7-14-13(8-10)17-15(19-14)11-4-2-3-5-12(11)16/h2-8H,1H3 |
| InChIKey | IHFNETVKICIAGD-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.70 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |