C10H8ClNO2 — CID 83754292
1-[2-(chloromethyl)-1,3-benzoxazol-5-yl]ethanone (PubChem CID 83754292) has the molecular formula C10H8ClNO2 and a molecular weight of 209.63 g/mol. Its IUPAC name is 1-[2-(chloromethyl)-1,3-benzoxazol-5-yl]ethanone.
| Compound Name | 1-[2-(chloromethyl)-1,3-benzoxazol-5-yl]ethanone |
|---|---|
| PubChem CID | 83754292 |
| Molecular Formula | C10H8ClNO2 |
| Molecular Weight | 209.63 g/mol |
| Exact Mass | 209.02 |
| IUPAC Name | 1-[2-(chloromethyl)-1,3-benzoxazol-5-yl]ethanone |
| SMILES | CC(=O)c1ccc2oc(CCl)nc2c1 |
| InChI | InChI=1S/C10H8ClNO2/c1-6(13)7-2-3-9-8(4-7)12-10(5-11)14-9/h2-4H,5H2,1H3 |
| InChIKey | UNZKWAPFUQYBOX-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.63 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|