C8H5BrClNO — CID 14204208
5-bromo-2-(chloromethyl)-1,3-benzoxazole (PubChem CID 14204208) has the molecular formula C8H5BrClNO and a molecular weight of 246.49 g/mol. Its IUPAC name is 5-bromo-2-(chloromethyl)-1,3-benzoxazole.
| Compound Name | 5-bromo-2-(chloromethyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 14204208 |
| Molecular Formula | C8H5BrClNO |
| Molecular Weight | 246.49 g/mol |
| Exact Mass | 244.92 |
| IUPAC Name | 5-bromo-2-(chloromethyl)-1,3-benzoxazole |
| SMILES | ClCc1nc2cc(Br)ccc2o1 |
| InChI | InChI=1S/C8H5BrClNO/c9-5-1-2-7-6(3-5)11-8(4-10)12-7/h1-3H,4H2 |
| InChIKey | CWONURXPYBVLGQ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.49 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|