C8H4BrCl2NO — CID 119086181
5-bromo-2-(dichloromethyl)-1,3-benzoxazole (PubChem CID 119086181) has the molecular formula C8H4BrCl2NO and a molecular weight of 280.94 g/mol. Its IUPAC name is 5-bromo-2-(dichloromethyl)-1,3-benzoxazole.
| Compound Name | 5-bromo-2-(dichloromethyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 119086181 |
| Molecular Formula | C8H4BrCl2NO |
| Molecular Weight | 280.94 g/mol |
| Exact Mass | 278.89 |
| IUPAC Name | 5-bromo-2-(dichloromethyl)-1,3-benzoxazole |
| SMILES | ClC(Cl)c1nc2cc(Br)ccc2o1 |
| InChI | InChI=1S/C8H4BrCl2NO/c9-4-1-2-6-5(3-4)12-8(13-6)7(10)11/h1-3,7H |
| InChIKey | CNRKWJOTOKVDSW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.94 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|