C9H7Cl2NO — CID 43115623
5-chloro-2-(1-chloroethyl)-1,3-benzoxazole (PubChem CID 43115623) has the molecular formula C9H7Cl2NO and a molecular weight of 216.07 g/mol. Its IUPAC name is 5-chloro-2-(1-chloroethyl)-1,3-benzoxazole.
| Compound Name | 5-chloro-2-(1-chloroethyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 43115623 |
| Molecular Formula | C9H7Cl2NO |
| Molecular Weight | 216.07 g/mol |
| Exact Mass | 214.99 |
| IUPAC Name | 5-chloro-2-(1-chloroethyl)-1,3-benzoxazole |
| SMILES | CC(Cl)c1nc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C9H7Cl2NO/c1-5(10)9-12-7-4-6(11)2-3-8(7)13-9/h2-5H,1H3 |
| InChIKey | ZLUXLJAPDFZTHP-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.07 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|